C14H26N2O4S — CID 35322838
methyl 1-[[(3R)-3-methylpiperidin-1-yl]sulfonylamino]cyclohexane-1-carboxylate (PubChem CID 35322838) has the molecular formula C14H26N2O4S and a molecular weight of 318.44 g/mol. Its IUPAC name is methyl 1-[[(3R)-3-methylpiperidin-1-yl]sulfonylamino]cyclohexane-1-carboxylate.
| Compound Name | methyl 1-[[(3R)-3-methylpiperidin-1-yl]sulfonylamino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 35322838 |
| Molecular Formula | C14H26N2O4S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | methyl 1-[[(3R)-3-methylpiperidin-1-yl]sulfonylamino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(NS(=O)(=O)N2CCC[C@@H](C)C2)CCCCC1 |
| InChI | InChI=1S/C14H26N2O4S/c1-12-7-6-10-16(11-12)21(18,19)15-14(13(17)20-2)8-4-3-5-9-14/h12,15H,3-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | IRSGCTRKKLSVFG-GFCCVEGCSA-N |
| XLogP | 1.43 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |