C13H24N2O4S — CID 79829978
methyl (2R)-1-(3-methylpiperidin-1-yl)sulfonylpiperidine-2-carboxylate (PubChem CID 79829978) has the molecular formula C13H24N2O4S and a molecular weight of 304.41 g/mol. Its IUPAC name is methyl (2R)-1-(3-methylpiperidin-1-yl)sulfonylpiperidine-2-carboxylate.
| Compound Name | methyl (2R)-1-(3-methylpiperidin-1-yl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 79829978 |
| Molecular Formula | C13H24N2O4S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | methyl (2R)-1-(3-methylpiperidin-1-yl)sulfonylpiperidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCCCN1S(=O)(=O)N1CCCC(C)C1 |
| InChI | InChI=1S/C13H24N2O4S/c1-11-6-5-8-14(10-11)20(17,18)15-9-4-3-7-12(15)13(16)19-2/h11-12H,3-10H2,1-2H3/t11?,12-/m1/s1 |
| InChIKey | HPUFRMPMALLZOL-PIJUOVFKSA-N |
| XLogP | 0.99 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |