C12H22N2O5S — CID 115971403
methyl 1-(azepan-1-ylsulfonyl)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 115971403) has the molecular formula C12H22N2O5S and a molecular weight of 306.38 g/mol. Its IUPAC name is methyl 1-(azepan-1-ylsulfonyl)-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(azepan-1-ylsulfonyl)-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 115971403 |
| Molecular Formula | C12H22N2O5S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | methyl 1-(azepan-1-ylsulfonyl)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(O)CN1S(=O)(=O)N1CCCCCC1 |
| InChI | InChI=1S/C12H22N2O5S/c1-19-12(16)11-8-10(15)9-14(11)20(17,18)13-6-4-2-3-5-7-13/h10-11,15H,2-9H2,1H3 |
| InChIKey | VMVOKVFTOOMONS-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |