C9H16N2O5S — CID 114811635
methyl 1-(cyclopropylsulfamoyl)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 114811635) has the molecular formula C9H16N2O5S and a molecular weight of 264.30 g/mol. Its IUPAC name is methyl 1-(cyclopropylsulfamoyl)-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(cyclopropylsulfamoyl)-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 114811635 |
| Molecular Formula | C9H16N2O5S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | methyl 1-(cyclopropylsulfamoyl)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(O)CN1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C9H16N2O5S/c1-16-9(13)8-4-7(12)5-11(8)17(14,15)10-6-2-3-6/h6-8,10,12H,2-5H2,1H3 |
| InChIKey | OPMDGVAUDXJZGX-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |