C8H15NO7S2 — CID 112632641
methyl 4-hydroxy-1-(methylsulfonylmethylsulfonyl)pyrrolidine-2-carboxylate (PubChem CID 112632641) has the molecular formula C8H15NO7S2 and a molecular weight of 301.34 g/mol. Its IUPAC name is methyl 4-hydroxy-1-(methylsulfonylmethylsulfonyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 4-hydroxy-1-(methylsulfonylmethylsulfonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 112632641 |
| Molecular Formula | C8H15NO7S2 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | methyl 4-hydroxy-1-(methylsulfonylmethylsulfonyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(O)CN1S(=O)(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C8H15NO7S2/c1-16-8(11)7-3-6(10)4-9(7)18(14,15)5-17(2,12)13/h6-7,10H,3-5H2,1-2H3 |
| InChIKey | XEHUJVOEBRPBOK-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |