C10H17NO6S — CID 113422292
methyl 4-hydroxy-1-(2-methylsulfonylpropanoyl)pyrrolidine-2-carboxylate (PubChem CID 113422292) has the molecular formula C10H17NO6S and a molecular weight of 279.31 g/mol. Its IUPAC name is methyl 4-hydroxy-1-(2-methylsulfonylpropanoyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 4-hydroxy-1-(2-methylsulfonylpropanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 113422292 |
| Molecular Formula | C10H17NO6S |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | methyl 4-hydroxy-1-(2-methylsulfonylpropanoyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(O)CN1C(=O)C(C)S(C)(=O)=O |
| InChI | InChI=1S/C10H17NO6S/c1-6(18(3,15)16)9(13)11-5-7(12)4-8(11)10(14)17-2/h6-8,12H,4-5H2,1-3H3 |
| InChIKey | QENSYMRATQNVRG-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |