C14H18O2S — CID 134243944
(3E,5Z)-4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfonylhepta-1,3,5-triene (PubChem CID 134243944) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is (3E,5Z)-4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfonylhepta-1,3,5-triene.
| Compound Name | (3E,5Z)-4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfonylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 134243944 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (3E,5Z)-4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]sulfonylhepta-1,3,5-triene |
| SMILES | C=C/C=C\C(=C/C)S(=O)(=O)C(/C=C\C)=C/C=C |
| InChI | InChI=1S/C14H18O2S/c1-5-9-12-13(8-4)17(15,16)14(10-6-2)11-7-3/h5-12H,1-2H2,3-4H3/b11-7-,12-9-,13-8+,14-10+ |
| InChIKey | HYLQELWWXZJREO-DILUHCKKSA-N |
| XLogP | 3.69 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|