C11H18O3S — CID 145077139
ethane;methyl (3E,5Z)-octa-1,3,5,7-tetraene-4-sulfonate (PubChem CID 145077139) has the molecular formula C11H18O3S and a molecular weight of 230.33 g/mol. Its IUPAC name is ethane;methyl (3E,5Z)-octa-1,3,5,7-tetraene-4-sulfonate.
| Compound Name | ethane;methyl (3E,5Z)-octa-1,3,5,7-tetraene-4-sulfonate |
|---|---|
| PubChem CID | 145077139 |
| Molecular Formula | C11H18O3S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | ethane;methyl (3E,5Z)-octa-1,3,5,7-tetraene-4-sulfonate |
| SMILES | C=C/C=C\C(=C/C=C)S(=O)(=O)OC.CC |
| InChI | InChI=1S/C9H12O3S.C2H6/c1-4-6-8-9(7-5-2)13(10,11)12-3;1-2/h4-8H,1-2H2,3H3;1-2H3/b8-6-,9-7+; |
| InChIKey | NCXFWEKTCGOLEO-JYWQNNPFSA-N |
| XLogP | 2.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|