C8H6N2 — CID 58922088
1,1-diisocyanohexa-1,3,5-triene (PubChem CID 58922088) has the molecular formula C8H6N2 and a molecular weight of 130.15 g/mol. Its IUPAC name is 1,1-diisocyanohexa-1,3,5-triene.
| Compound Name | 1,1-diisocyanohexa-1,3,5-triene |
|---|---|
| PubChem CID | 58922088 |
| Molecular Formula | C8H6N2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | 1,1-diisocyanohexa-1,3,5-triene |
| SMILES | [C-]#[N+]C(=CC=CC=C)[N+]#[C-] |
| InChI | InChI=1S/C8H6N2/c1-4-5-6-7-8(9-2)10-3/h4-7H,1H2 |
| InChIKey | GZVHDJFABSPMKI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 8.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|