C7H12NP — CID 89368942
(2Z,4Z)-1-phosphanylhepta-2,4,6-trien-2-amine (PubChem CID 89368942) has the molecular formula C7H12NP and a molecular weight of 141.15 g/mol. Its IUPAC name is (2Z,4Z)-1-phosphanylhepta-2,4,6-trien-2-amine.
| Compound Name | (2Z,4Z)-1-phosphanylhepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 89368942 |
| Molecular Formula | C7H12NP |
| Molecular Weight | 141.15 g/mol |
| Exact Mass | 141.07 |
| IUPAC Name | (2Z,4Z)-1-phosphanylhepta-2,4,6-trien-2-amine |
| SMILES | C=C/C=C\C=C(/N)CP |
| InChI | InChI=1S/C7H12NP/c1-2-3-4-5-7(8)6-9/h2-5H,1,6,8-9H2/b4-3-,7-5- |
| InChIKey | MESODFWWBQGBRN-MRWCJKGFSA-N |
| XLogP | 1.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.15 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|