C19H35N — CID 167179405
(3Z,5Z)-7-butyl-7-methyltetradeca-1,3,5-trien-6-amine (PubChem CID 167179405) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is (3Z,5Z)-7-butyl-7-methyltetradeca-1,3,5-trien-6-amine.
| Compound Name | (3Z,5Z)-7-butyl-7-methyltetradeca-1,3,5-trien-6-amine |
|---|---|
| PubChem CID | 167179405 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | (3Z,5Z)-7-butyl-7-methyltetradeca-1,3,5-trien-6-amine |
| SMILES | C=C/C=C\C=C(/N)C(C)(CCCC)CCCCCCC |
| InChI | InChI=1S/C19H35N/c1-5-8-11-12-14-17-19(4,16-10-7-3)18(20)15-13-9-6-2/h6,9,13,15H,2,5,7-8,10-12,14,16-17,20H2,1,3-4H3/b13-9-,18-15- |
| InChIKey | NIYOVQZLHDUSIP-RCOCBCEFSA-N |
| XLogP | 6.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|