C21H37N — CID 138502761
(3Z)-N-ethenyl-6-hexyl-6-methyldodeca-1,3-dien-5-imine (PubChem CID 138502761) has the molecular formula C21H37N and a molecular weight of 303.53 g/mol. Its IUPAC name is (3Z)-N-ethenyl-6-hexyl-6-methyldodeca-1,3-dien-5-imine.
| Compound Name | (3Z)-N-ethenyl-6-hexyl-6-methyldodeca-1,3-dien-5-imine |
|---|---|
| PubChem CID | 138502761 |
| Molecular Formula | C21H37N |
| Molecular Weight | 303.53 g/mol |
| Exact Mass | 303.29 |
| IUPAC Name | (3Z)-N-ethenyl-6-hexyl-6-methyldodeca-1,3-dien-5-imine |
| SMILES | C=C/C=C\C(=N/C=C)C(C)(CCCCCC)CCCCCC |
| InChI | InChI=1S/C21H37N/c1-6-10-13-15-18-21(5,19-16-14-11-7-2)20(22-9-4)17-12-8-3/h8-9,12,17H,3-4,6-7,10-11,13-16,18-19H2,1-2,5H3/b17-12-,22-20+ |
| InChIKey | AZHHCWIAUYLTPY-RORPNGENSA-N |
| XLogP | 7.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.53 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|