C27H51N — CID 146578029
(E)-N,9-bis(ethenyl)-10-hexyl-10-methylhexadec-8-en-8-amine (PubChem CID 146578029) has the molecular formula C27H51N and a molecular weight of 389.71 g/mol. Its IUPAC name is (E)-N,9-bis(ethenyl)-10-hexyl-10-methylhexadec-8-en-8-amine.
| Compound Name | (E)-N,9-bis(ethenyl)-10-hexyl-10-methylhexadec-8-en-8-amine |
|---|---|
| PubChem CID | 146578029 |
| Molecular Formula | C27H51N |
| Molecular Weight | 389.71 g/mol |
| Exact Mass | 389.40 |
| IUPAC Name | (E)-N,9-bis(ethenyl)-10-hexyl-10-methylhexadec-8-en-8-amine |
| SMILES | C=CN/C(CCCCCCC)=C(\C=C)C(C)(CCCCCC)CCCCCC |
| InChI | InChI=1S/C27H51N/c1-7-12-15-18-19-22-26(28-11-5)25(10-4)27(6,23-20-16-13-8-2)24-21-17-14-9-3/h10-11,28H,4-5,7-9,12-24H2,1-3,6H3/b26-25+ |
| InChIKey | CZRHTETXIPDGNH-OCEACIFDSA-N |
| XLogP | 9.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.71 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|