About N-ethenyldodecanamide
N-ethenyldodecanamide (PubChem CID 21219286) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is N-ethenyldodecanamide.
Molecular Properties
| Compound Name | N-ethenyldodecanamide |
| PubChem CID | 21219286 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | N-ethenyldodecanamide |
| SMILES | C=CNC(=O)CCCCCCCCCCC |
| InChI | InChI=1S/C14H27NO/c1-3-5-6-7-8-9-10-11-12-13-14(16)15-4-2/h4H,2-3,5-13H2,1H3,(H,15,16) |
| InChIKey | UNVMOPYJBABOAS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyldodecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyldodecanamide?
The IUPAC name of N-ethenyldodecanamide (CID 21219286) is N-ethenyldodecanamide.
What is the SMILES notation for N-ethenyldodecanamide?
The canonical SMILES for N-ethenyldodecanamide is C=CNC(=O)CCCCCCCCCCC.
What is the InChIKey of N-ethenyldodecanamide?
The InChIKey is UNVMOPYJBABOAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO/c1-3-5-6-7-8-9-10-11-12-13-14(16)15-4-2/h4H,2-3,5-13H2,1H3,(H,15,16).
What are the key properties of N-ethenyldodecanamide?
N-ethenyldodecanamide has a molecular weight of 225.38 g/mol, XLogP of 4.17, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyldodecanamide is sourced from PubChem (CID 21219286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).