About N-hydroperoxynonanamide
N-hydroperoxynonanamide (PubChem CID 54468207) has the molecular formula C9H19NO3
and a molecular weight of 189.25 g/mol. Its IUPAC name is N-hydroperoxynonanamide.
Molecular Properties
| Compound Name | N-hydroperoxynonanamide |
| PubChem CID | 54468207 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | N-hydroperoxynonanamide |
| SMILES | CCCCCCCCC(=O)NOO |
| InChI | InChI=1S/C9H19NO3/c1-2-3-4-5-6-7-8-9(11)10-13-12/h12H,2-8H2,1H3,(H,10,11) |
| InChIKey | DKUFCNGGEVCQEI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze N-hydroperoxynonanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroperoxynonanamide?
The IUPAC name of N-hydroperoxynonanamide (CID 54468207) is N-hydroperoxynonanamide.
What is the SMILES notation for N-hydroperoxynonanamide?
The canonical SMILES for N-hydroperoxynonanamide is CCCCCCCCC(=O)NOO.
What is the InChIKey of N-hydroperoxynonanamide?
The InChIKey is DKUFCNGGEVCQEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3/c1-2-3-4-5-6-7-8-9(11)10-13-12/h12H,2-8H2,1H3,(H,10,11).
What are the key properties of N-hydroperoxynonanamide?
N-hydroperoxynonanamide has a molecular weight of 189.25 g/mol, XLogP of 2.26, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroperoxynonanamide is sourced from PubChem (CID 54468207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).