About N-formyloctadecanamide
N-formyloctadecanamide (PubChem CID 54418147) has the molecular formula C19H37NO2
and a molecular weight of 311.51 g/mol. Its IUPAC name is N-formyloctadecanamide.
Molecular Properties
| Compound Name | N-formyloctadecanamide |
| PubChem CID | 54418147 |
| Molecular Formula | C19H37NO2 |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.28 |
| IUPAC Name | N-formyloctadecanamide |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)NC=O |
| InChI | InChI=1S/C19H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22)20-18-21/h18H,2-17H2,1H3,(H,20,21,22) |
| InChIKey | VYXCDKHHZKOGJJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-formyloctadecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-formyloctadecanamide?
The IUPAC name of N-formyloctadecanamide (CID 54418147) is N-formyloctadecanamide.
What is the SMILES notation for N-formyloctadecanamide?
The canonical SMILES for N-formyloctadecanamide is CCCCCCCCCCCCCCCCCC(=O)NC=O.
What is the InChIKey of N-formyloctadecanamide?
The InChIKey is VYXCDKHHZKOGJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22)20-18-21/h18H,2-17H2,1H3,(H,20,21,22).
What are the key properties of N-formyloctadecanamide?
N-formyloctadecanamide has a molecular weight of 311.51 g/mol, XLogP of 5.52, 17 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-formyloctadecanamide is sourced from PubChem (CID 54418147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).