About N-iodooctanamide
N-iodooctanamide (PubChem CID 19040107) has the molecular formula C8H16INO
and a molecular weight of 269.13 g/mol. Its IUPAC name is N-iodooctanamide.
Molecular Properties
| Compound Name | N-iodooctanamide |
| PubChem CID | 19040107 |
| Molecular Formula | C8H16INO |
| Molecular Weight | 269.13 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | N-iodooctanamide |
| SMILES | CCCCCCCC(=O)NI |
| InChI | InChI=1S/C8H16INO/c1-2-3-4-5-6-7-8(11)10-9/h2-7H2,1H3,(H,10,11) |
| InChIKey | WKWLIGDFRWMWBQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.13 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-iodooctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-iodooctanamide?
The IUPAC name of N-iodooctanamide (CID 19040107) is N-iodooctanamide.
What is the SMILES notation for N-iodooctanamide?
The canonical SMILES for N-iodooctanamide is CCCCCCCC(=O)NI.
What is the InChIKey of N-iodooctanamide?
The InChIKey is WKWLIGDFRWMWBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16INO/c1-2-3-4-5-6-7-8(11)10-9/h2-7H2,1H3,(H,10,11).
What are the key properties of N-iodooctanamide?
N-iodooctanamide has a molecular weight of 269.13 g/mol, XLogP of 2.81, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-iodooctanamide is sourced from PubChem (CID 19040107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).