About N-oxidotetradecanamide
N-oxidotetradecanamide (PubChem CID 23094369) has the molecular formula C14H28NO2-
and a molecular weight of 242.38 g/mol. Its IUPAC name is N-oxidotetradecanamide.
Molecular Properties
| Compound Name | N-oxidotetradecanamide |
| PubChem CID | 23094369 |
| Molecular Formula | C14H28NO2- |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | N-oxidotetradecanamide |
| SMILES | CCCCCCCCCCCCCC(=O)N[O-] |
| InChI | InChI=1S/C14H28NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(16)15-17/h2-13H2,1H3,(H-,15,16,17)/q-1 |
| InChIKey | RXPCCKQPXZRJGI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-oxidotetradecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-oxidotetradecanamide?
The IUPAC name of N-oxidotetradecanamide (CID 23094369) is N-oxidotetradecanamide.
What is the SMILES notation for N-oxidotetradecanamide?
The canonical SMILES for N-oxidotetradecanamide is CCCCCCCCCCCCCC(=O)N[O-].
What is the InChIKey of N-oxidotetradecanamide?
The InChIKey is RXPCCKQPXZRJGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(16)15-17/h2-13H2,1H3,(H-,15,16,17)/q-1.
What are the key properties of N-oxidotetradecanamide?
N-oxidotetradecanamide has a molecular weight of 242.38 g/mol, XLogP of 4.30, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-oxidotetradecanamide is sourced from PubChem (CID 23094369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).