About N-chlorodocosanamide
N-chlorodocosanamide (PubChem CID 141032944) has the molecular formula C22H44ClNO
and a molecular weight of 374.05 g/mol. Its IUPAC name is N-chlorodocosanamide.
Molecular Properties
| Compound Name | N-chlorodocosanamide |
| PubChem CID | 141032944 |
| Molecular Formula | C22H44ClNO |
| Molecular Weight | 374.05 g/mol |
| Exact Mass | 373.31 |
| IUPAC Name | N-chlorodocosanamide |
| SMILES | CCCCCCCCCCCCCCCCCCCCCC(=O)NCl |
| InChI | InChI=1S/C22H44ClNO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(25)24-23/h2-21H2,1H3,(H,24,25) |
| InChIKey | ZUYVNBDLAZEDLR-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.05 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-chlorodocosanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-chlorodocosanamide?
The IUPAC name of N-chlorodocosanamide (CID 141032944) is N-chlorodocosanamide.
What is the SMILES notation for N-chlorodocosanamide?
The canonical SMILES for N-chlorodocosanamide is CCCCCCCCCCCCCCCCCCCCCC(=O)NCl.
What is the InChIKey of N-chlorodocosanamide?
The InChIKey is ZUYVNBDLAZEDLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44ClNO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(25)24-23/h2-21H2,1H3,(H,24,25).
What are the key properties of N-chlorodocosanamide?
N-chlorodocosanamide has a molecular weight of 374.05 g/mol, XLogP of 8.08, 20 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-chlorodocosanamide is sourced from PubChem (CID 141032944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).