C30H56N2O2 — CID 101279984
N,N'-bis[(E)-dodec-1-enyl]hexanediamide (PubChem CID 101279984) has the molecular formula C30H56N2O2 and a molecular weight of 476.79 g/mol. Its IUPAC name is N,N'-bis[(E)-dodec-1-enyl]hexanediamide.
| Compound Name | N,N'-bis[(E)-dodec-1-enyl]hexanediamide |
|---|---|
| PubChem CID | 101279984 |
| Molecular Formula | C30H56N2O2 |
| Molecular Weight | 476.79 g/mol |
| Exact Mass | 476.43 |
| IUPAC Name | N,N'-bis[(E)-dodec-1-enyl]hexanediamide |
| SMILES | CCCCCCCCCC/C=C/NC(=O)CCCCC(=O)N/C=C/CCCCCCCCCC |
| InChI | InChI=1S/C30H56N2O2/c1-3-5-7-9-11-13-15-17-19-23-27-31-29(33)25-21-22-26-30(34)32-28-24-20-18-16-14-12-10-8-6-4-2/h23-24,27-28H,3-22,25-26H2,1-2H3,(H,31,33)(H,32,34)/b27-23+,28-24+ |
| InChIKey | WNVLYIDMCZYGIY-LMCGJEQXSA-N |
| XLogP | 8.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.79 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|