About N-propoxyoctanamide
N-propoxyoctanamide (PubChem CID 174987362) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is N-propoxyoctanamide.
Molecular Properties
| Compound Name | N-propoxyoctanamide |
| PubChem CID | 174987362 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | N-propoxyoctanamide |
| SMILES | CCCCCCCC(=O)NOCCC |
| InChI | InChI=1S/C11H23NO2/c1-3-5-6-7-8-9-11(13)12-14-10-4-2/h3-10H2,1-2H3,(H,12,13) |
| InChIKey | ZVYPAXTZRRTUDC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-propoxyoctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propoxyoctanamide?
The IUPAC name of N-propoxyoctanamide (CID 174987362) is N-propoxyoctanamide.
What is the SMILES notation for N-propoxyoctanamide?
The canonical SMILES for N-propoxyoctanamide is CCCCCCCC(=O)NOCCC.
What is the InChIKey of N-propoxyoctanamide?
The InChIKey is ZVYPAXTZRRTUDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-3-5-6-7-8-9-11(13)12-14-10-4-2/h3-10H2,1-2H3,(H,12,13).
What are the key properties of N-propoxyoctanamide?
N-propoxyoctanamide has a molecular weight of 201.31 g/mol, XLogP of 2.80, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-propoxyoctanamide is sourced from PubChem (CID 174987362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).