C12H14O — CID 145478435
(1Z,3Z)-1-[(3E)-hexa-1,3,5-trien-3-yl]oxyhexa-1,3,5-triene (PubChem CID 145478435) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is (1Z,3Z)-1-[(3E)-hexa-1,3,5-trien-3-yl]oxyhexa-1,3,5-triene.
| Compound Name | (1Z,3Z)-1-[(3E)-hexa-1,3,5-trien-3-yl]oxyhexa-1,3,5-triene |
|---|---|
| PubChem CID | 145478435 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (1Z,3Z)-1-[(3E)-hexa-1,3,5-trien-3-yl]oxyhexa-1,3,5-triene |
| SMILES | C=C/C=C\C=C/O/C(C=C)=C/C=C |
| InChI | InChI=1S/C12H14O/c1-4-7-8-9-11-13-12(6-3)10-5-2/h4-11H,1-3H2/b8-7-,11-9-,12-10+ |
| InChIKey | QZRNCLJNLODRFT-KGLDOBFESA-N |
| XLogP | 3.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|