C11H16O3S — CID 157222187
1-[[(3E,5E)-hepta-1,3,5-trien-3-yl]-methylidene-oxo-λ6-sulfanyl]oxypropan-2-one (PubChem CID 157222187) has the molecular formula C11H16O3S and a molecular weight of 228.31 g/mol. Its IUPAC name is 1-[[(3E,5E)-hepta-1,3,5-trien-3-yl]-methylidene-oxo-λ6-sulfanyl]oxypropan-2-one.
| Compound Name | 1-[[(3E,5E)-hepta-1,3,5-trien-3-yl]-methylidene-oxo-λ6-sulfanyl]oxypropan-2-one |
|---|---|
| PubChem CID | 157222187 |
| Molecular Formula | C11H16O3S |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 1-[[(3E,5E)-hepta-1,3,5-trien-3-yl]-methylidene-oxo-λ6-sulfanyl]oxypropan-2-one |
| SMILES | C=C/C(=C\C=C\C)S(=C)(=O)OCC(C)=O |
| InChI | InChI=1S/C11H16O3S/c1-5-7-8-11(6-2)15(4,13)14-9-10(3)12/h5-8H,2,4,9H2,1,3H3/b7-5+,11-8+ |
| InChIKey | USSMAZDYASXFAK-PAQHSLSSSA-N |
| XLogP | 1.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|