C18H32N2O2 — CID 145125978
N,N-diethylacetamide;(2E,4Z)-2-ethenyl-N,N-diethylhexa-2,4-dienamide (PubChem CID 145125978) has the molecular formula C18H32N2O2 and a molecular weight of 308.47 g/mol. Its IUPAC name is N,N-diethylacetamide;(2E,4Z)-2-ethenyl-N,N-diethylhexa-2,4-dienamide.
| Compound Name | N,N-diethylacetamide;(2E,4Z)-2-ethenyl-N,N-diethylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 145125978 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | N,N-diethylacetamide;(2E,4Z)-2-ethenyl-N,N-diethylhexa-2,4-dienamide |
| SMILES | C=C/C(=C\C=C/C)C(=O)N(CC)CC.CCN(CC)C(C)=O |
| InChI | InChI=1S/C12H19NO.C6H13NO/c1-5-9-10-11(6-2)12(14)13(7-3)8-4;1-4-7(5-2)6(3)8/h5-6,9-10H,2,7-8H2,1,3-4H3;4-5H2,1-3H3/b9-5-,11-10+; |
| InChIKey | DEEXLYWMKIEMAM-PKVWVGCKSA-N |
| XLogP | 3.42 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|