About but-3-en-2-one;dimethyl-methylidene-oxo-λ6-sulfane
but-3-en-2-one;dimethyl-methylidene-oxo-λ6-sulfane (PubChem CID 159903560) has the molecular formula C7H14O2S
and a molecular weight of 162.25 g/mol. Its IUPAC name is but-3-en-2-one;dimethyl-methylidene-oxo-λ6-sulfane.
Molecular Properties
| Compound Name | but-3-en-2-one;dimethyl-methylidene-oxo-λ6-sulfane |
| PubChem CID | 159903560 |
| Molecular Formula | C7H14O2S |
| Molecular Weight | 162.25 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | but-3-en-2-one;dimethyl-methylidene-oxo-λ6-sulfane |
| SMILES | C=CC(C)=O.C=S(C)(C)=O |
| InChI | InChI=1S/C4H6O.C3H8OS/c1-3-4(2)5;1-5(2,3)4/h3H,1H2,2H3;1H2,2-3H3 |
| InChIKey | NWGSGASRMCAHID-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze but-3-en-2-one;dimethyl-methylidene-oxo-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-en-2-one;dimethyl-methylidene-oxo-λ6-sulfane?
The IUPAC name of but-3-en-2-one;dimethyl-methylidene-oxo-λ6-sulfane (CID 159903560) is but-3-en-2-one;dimethyl-methylidene-oxo-λ6-sulfane.
What is the SMILES notation for but-3-en-2-one;dimethyl-methylidene-oxo-λ6-sulfane?
The canonical SMILES for but-3-en-2-one;dimethyl-methylidene-oxo-λ6-sulfane is C=CC(C)=O.C=S(C)(C)=O.
What is the InChIKey of but-3-en-2-one;dimethyl-methylidene-oxo-λ6-sulfane?
The InChIKey is NWGSGASRMCAHID-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O.C3H8OS/c1-3-4(2)5;1-5(2,3)4/h3H,1H2,2H3;1H2,2-3H3.
What are the key properties of but-3-en-2-one;dimethyl-methylidene-oxo-λ6-sulfane?
but-3-en-2-one;dimethyl-methylidene-oxo-λ6-sulfane has a molecular weight of 162.25 g/mol, XLogP of 0.72, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-en-2-one;dimethyl-methylidene-oxo-λ6-sulfane is sourced from PubChem (CID 159903560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).