C19H27NO2S — CID 118219094
3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfonylpiperidine (PubChem CID 118219094) has the molecular formula C19H27NO2S and a molecular weight of 333.50 g/mol. Its IUPAC name is 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfonylpiperidine.
| Compound Name | 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfonylpiperidine |
|---|---|
| PubChem CID | 118219094 |
| Molecular Formula | C19H27NO2S |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfonylpiperidine |
| SMILES | C=C/C(=C\C=C/C)C1(S(=O)(=O)/C(C=C)=C/C=C\C)CCCNC1 |
| InChI | InChI=1S/C19H27NO2S/c1-5-9-12-17(7-3)19(14-11-15-20-16-19)23(21,22)18(8-4)13-10-6-2/h5-10,12-13,20H,3-4,11,14-16H2,1-2H3/b9-5-,10-6-,17-12+,18-13+ |
| InChIKey | RANZRZFPZVUPKQ-SFMNTGTRSA-N |
| XLogP | 3.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|