C21H30N2O — CID 146515958
N-[N-ethenyl-C-[(Z)-prop-1-enyl]carbonimidoyl]-1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]cycloheptane-1-carboxamide (PubChem CID 146515958) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is N-[N-ethenyl-C-[(Z)-prop-1-enyl]carbonimidoyl]-1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]cycloheptane-1-carboxamide.
| Compound Name | N-[N-ethenyl-C-[(Z)-prop-1-enyl]carbonimidoyl]-1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]cycloheptane-1-carboxamide |
|---|---|
| PubChem CID | 146515958 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | N-[N-ethenyl-C-[(Z)-prop-1-enyl]carbonimidoyl]-1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]cycloheptane-1-carboxamide |
| SMILES | C=C/N=C(\C=C/C)NC(=O)C1(/C(C=C)=C/C=C\C)CCCCCC1 |
| InChI | InChI=1S/C21H30N2O/c1-5-9-15-18(7-3)21(16-12-10-11-13-17-21)20(24)23-19(14-6-2)22-8-4/h5-9,14-15H,3-4,10-13,16-17H2,1-2H3,(H,22,23,24)/b9-5-,14-6-,18-15+ |
| InChIKey | LGJWINVMLWHFAR-WVKMUONOSA-N |
| XLogP | 5.25 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|