C18H26O — CID 130383294
(3E,5E)-6-[1-[(3E)-penta-1,3-dien-3-yl]cyclohexyl]hepta-1,3,5-trien-3-ol (PubChem CID 130383294) has the molecular formula C18H26O and a molecular weight of 258.41 g/mol. Its IUPAC name is (3E,5E)-6-[1-[(3E)-penta-1,3-dien-3-yl]cyclohexyl]hepta-1,3,5-trien-3-ol.
| Compound Name | (3E,5E)-6-[1-[(3E)-penta-1,3-dien-3-yl]cyclohexyl]hepta-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 130383294 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (3E,5E)-6-[1-[(3E)-penta-1,3-dien-3-yl]cyclohexyl]hepta-1,3,5-trien-3-ol |
| SMILES | C=C/C(O)=C\C=C(/C)C1(/C(C=C)=C/C)CCCCC1 |
| InChI | InChI=1S/C18H26O/c1-5-16(6-2)18(13-9-8-10-14-18)15(4)11-12-17(19)7-3/h5-7,11-12,19H,1,3,8-10,13-14H2,2,4H3/b15-11+,16-6+,17-12+ |
| InChIKey | MRLOVZKNCNCFNL-XHHGTZLQSA-N |
| XLogP | 5.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|