C10H15N — CID 168970776
1-[(3E)-hexa-1,3,5-trien-3-yl]cyclobutan-1-amine (PubChem CID 168970776) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 1-[(3E)-hexa-1,3,5-trien-3-yl]cyclobutan-1-amine.
| Compound Name | 1-[(3E)-hexa-1,3,5-trien-3-yl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 168970776 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 1-[(3E)-hexa-1,3,5-trien-3-yl]cyclobutan-1-amine |
| SMILES | C=C/C=C(\C=C)C1(N)CCC1 |
| InChI | InChI=1S/C10H15N/c1-3-6-9(4-2)10(11)7-5-8-10/h3-4,6H,1-2,5,7-8,11H2/b9-6+ |
| InChIKey | MAJTYGCFPDIRKJ-RMKNXTFCSA-N |
| XLogP | 2.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|