C23H34 — CID 145389337
1-[(3E)-hexa-1,3,5-trien-3-yl]-1,3-dimethyl-3-[(2E,4Z)-6-methylocta-2,4,7-trien-3-yl]cyclohexane (PubChem CID 145389337) has the molecular formula C23H34 and a molecular weight of 310.53 g/mol. Its IUPAC name is 1-[(3E)-hexa-1,3,5-trien-3-yl]-1,3-dimethyl-3-[(2E,4Z)-6-methylocta-2,4,7-trien-3-yl]cyclohexane.
| Compound Name | 1-[(3E)-hexa-1,3,5-trien-3-yl]-1,3-dimethyl-3-[(2E,4Z)-6-methylocta-2,4,7-trien-3-yl]cyclohexane |
|---|---|
| PubChem CID | 145389337 |
| Molecular Formula | C23H34 |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | 1-[(3E)-hexa-1,3,5-trien-3-yl]-1,3-dimethyl-3-[(2E,4Z)-6-methylocta-2,4,7-trien-3-yl]cyclohexane |
| SMILES | C=C/C=C(\C=C)C1(C)CCCC(C)(C(/C=C\C(C)C=C)=C/C)C1 |
| InChI | InChI=1S/C23H34/c1-8-13-20(10-3)22(6)16-12-17-23(7,18-22)21(11-4)15-14-19(5)9-2/h8-11,13-15,19H,1-3,12,16-18H2,4-7H3/b15-14-,20-13+,21-11+ |
| InChIKey | GNEXPOHVBLIPHK-FEGUJEJJSA-N |
| XLogP | 7.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|