C14H22N2 — CID 143493874
ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]piperidine-4-carbonitrile (PubChem CID 143493874) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]piperidine-4-carbonitrile.
| Compound Name | ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 143493874 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | ethane;4-[(3E)-hexa-1,3,5-trien-3-yl]piperidine-4-carbonitrile |
| SMILES | C=C/C=C(\C=C)C1(C#N)CCNCC1.CC |
| InChI | InChI=1S/C12H16N2.C2H6/c1-3-5-11(4-2)12(10-13)6-8-14-9-7-12;1-2/h3-5,14H,1-2,6-9H2;1-2H3/b11-5+; |
| InChIKey | ZYNBLPSHPMLOFQ-HMXKFKBXSA-N |
| XLogP | 3.20 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|