C16H32N2O2S — CID 142909233
N-cyclopropyl-N-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylpiperidin-4-amine;ethane;dihydrate (PubChem CID 142909233) has the molecular formula C16H32N2O2S and a molecular weight of 316.51 g/mol. Its IUPAC name is N-cyclopropyl-N-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylpiperidin-4-amine;ethane;dihydrate.
| Compound Name | N-cyclopropyl-N-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylpiperidin-4-amine;ethane;dihydrate |
|---|---|
| PubChem CID | 142909233 |
| Molecular Formula | C16H32N2O2S |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | N-cyclopropyl-N-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylpiperidin-4-amine;ethane;dihydrate |
| SMILES | C=C/C=C(\C=C)SN(C1CCNCC1)C1CC1.CC.O.O |
| InChI | InChI=1S/C14H22N2S.C2H6.2H2O/c1-3-5-14(4-2)17-16(12-6-7-12)13-8-10-15-11-9-13;1-2;;/h3-5,12-13,15H,1-2,6-11H2;1-2H3;2*1H2/b14-5+;;; |
| InChIKey | JZCIWHWSTFGCKT-JJTBOVLSSA-N |
| XLogP | 2.48 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|