C17H28S — CID 172616518
ethane;(3E,5Z)-4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylhepta-1,3,5-triene (PubChem CID 172616518) has the molecular formula C17H28S and a molecular weight of 264.48 g/mol. Its IUPAC name is ethane;(3E,5Z)-4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylhepta-1,3,5-triene.
| Compound Name | ethane;(3E,5Z)-4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 172616518 |
| Molecular Formula | C17H28S |
| Molecular Weight | 264.48 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | ethane;(3E,5Z)-4-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylhepta-1,3,5-triene |
| SMILES | C=C/C=C(\C=C)SC(/C=C\C)=C/C=C.CC.CC |
| InChI | InChI=1S/C13H16S.2C2H6/c1-5-9-12(8-4)14-13(10-6-2)11-7-3;2*1-2/h5-11H,1-2,4H2,3H3;2*1-2H3/b11-7-,12-9+,13-10+;; |
| InChIKey | ITOOUOBJHRMQGT-MYXXEYRISA-N |
| XLogP | 6.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.48 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|