C16H18S — CID 170360355
(3E,5Z)-4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]sulfanylocta-1,3,5,7-tetraene (PubChem CID 170360355) has the molecular formula C16H18S and a molecular weight of 242.39 g/mol. Its IUPAC name is (3E,5Z)-4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]sulfanylocta-1,3,5,7-tetraene.
| Compound Name | (3E,5Z)-4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]sulfanylocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 170360355 |
| Molecular Formula | C16H18S |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (3E,5Z)-4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]sulfanylocta-1,3,5,7-tetraene |
| SMILES | C=C/C=C\C(=C/C=C)SC(/C=C\C=C)=C/C=C |
| InChI | InChI=1S/C16H18S/c1-5-9-13-15(11-7-3)17-16(12-8-4)14-10-6-2/h5-14H,1-4H2/b13-9-,14-10-,15-11+,16-12+ |
| InChIKey | KSLQIZPUTJRPDT-NTJPYOIESA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|