C13H18 — CID 145164686
(3Z,6Z)-4-methyl-5-propan-2-ylidenenona-1,3,6,8-tetraene (PubChem CID 145164686) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is (3Z,6Z)-4-methyl-5-propan-2-ylidenenona-1,3,6,8-tetraene.
| Compound Name | (3Z,6Z)-4-methyl-5-propan-2-ylidenenona-1,3,6,8-tetraene |
|---|---|
| PubChem CID | 145164686 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | (3Z,6Z)-4-methyl-5-propan-2-ylidenenona-1,3,6,8-tetraene |
| SMILES | C=C/C=C\C(=C(C)C)/C(C)=C/C=C |
| InChI | InChI=1S/C13H18/c1-6-8-10-13(11(3)4)12(5)9-7-2/h6-10H,1-2H2,3-5H3/b10-8-,12-9- |
| InChIKey | HUTPYCUIPHAFEF-GGXBSVTOSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|