C18H24 — CID 177318715
(3Z,8Z,10Z)-8-ethenyl-6-methylidene-5-propan-2-ylidenedodeca-1,3,8,10-tetraene (PubChem CID 177318715) has the molecular formula C18H24 and a molecular weight of 240.39 g/mol. Its IUPAC name is (3Z,8Z,10Z)-8-ethenyl-6-methylidene-5-propan-2-ylidenedodeca-1,3,8,10-tetraene.
| Compound Name | (3Z,8Z,10Z)-8-ethenyl-6-methylidene-5-propan-2-ylidenedodeca-1,3,8,10-tetraene |
|---|---|
| PubChem CID | 177318715 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | (3Z,8Z,10Z)-8-ethenyl-6-methylidene-5-propan-2-ylidenedodeca-1,3,8,10-tetraene |
| SMILES | C=C/C=C\C(C(=C)C/C(C=C)=C/C=C\C)=C(C)C |
| InChI | InChI=1S/C18H24/c1-7-10-12-17(9-3)14-16(6)18(15(4)5)13-11-8-2/h7-13H,2-3,6,14H2,1,4-5H3/b10-7-,13-11-,17-12+ |
| InChIKey | KAILUAIKXPTFJJ-TWONWCFGSA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|