C8H11ClS — CID 153339188
[(2E,4Z)-2-ethenylhexa-2,4-dienyl] thiohypochlorite (PubChem CID 153339188) has the molecular formula C8H11ClS and a molecular weight of 174.70 g/mol. Its IUPAC name is [(2E,4Z)-2-ethenylhexa-2,4-dienyl] thiohypochlorite.
| Compound Name | [(2E,4Z)-2-ethenylhexa-2,4-dienyl] thiohypochlorite |
|---|---|
| PubChem CID | 153339188 |
| Molecular Formula | C8H11ClS |
| Molecular Weight | 174.70 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | [(2E,4Z)-2-ethenylhexa-2,4-dienyl] thiohypochlorite |
| SMILES | C=C/C(=C\C=C/C)CSCl |
| InChI | InChI=1S/C8H11ClS/c1-3-5-6-8(4-2)7-10-9/h3-6H,2,7H2,1H3/b5-3-,8-6+ |
| InChIKey | IRFFVSANHVILFU-CUKJDEOPSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.70 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|