C13H21NO — CID 153342117
(6Z,8Z)-4-amino-6-ethenyl-2-methyldeca-6,8-dien-3-one (PubChem CID 153342117) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (6Z,8Z)-4-amino-6-ethenyl-2-methyldeca-6,8-dien-3-one.
| Compound Name | (6Z,8Z)-4-amino-6-ethenyl-2-methyldeca-6,8-dien-3-one |
|---|---|
| PubChem CID | 153342117 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (6Z,8Z)-4-amino-6-ethenyl-2-methyldeca-6,8-dien-3-one |
| SMILES | C=C/C(=C\C=C/C)CC(N)C(=O)C(C)C |
| InChI | InChI=1S/C13H21NO/c1-5-7-8-11(6-2)9-12(14)13(15)10(3)4/h5-8,10,12H,2,9,14H2,1,3-4H3/b7-5-,11-8+ |
| InChIKey | YJVSOHFUAHALIT-UKJSTWFMSA-N |
| XLogP | 2.62 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|