C18H26 — CID 143216884
(3E,7Z,9Z)-7-ethenyl-5,5-dimethyl-4-[(Z)-prop-1-enyl]undeca-1,3,7,9-tetraene (PubChem CID 143216884) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is (3E,7Z,9Z)-7-ethenyl-5,5-dimethyl-4-[(Z)-prop-1-enyl]undeca-1,3,7,9-tetraene.
| Compound Name | (3E,7Z,9Z)-7-ethenyl-5,5-dimethyl-4-[(Z)-prop-1-enyl]undeca-1,3,7,9-tetraene |
|---|---|
| PubChem CID | 143216884 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | (3E,7Z,9Z)-7-ethenyl-5,5-dimethyl-4-[(Z)-prop-1-enyl]undeca-1,3,7,9-tetraene |
| SMILES | C=C/C=C(\C=C/C)C(C)(C)C/C(C=C)=C/C=C\C |
| InChI | InChI=1S/C18H26/c1-7-11-14-16(10-4)15-18(5,6)17(12-8-2)13-9-3/h7-14H,2,4,15H2,1,3,5-6H3/b11-7-,13-9-,16-14+,17-12+ |
| InChIKey | QKSVNUBNWGDMJH-UCKLADJOSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|