C14H24S — CID 134354782
(5E,7Z)-4,4-dimethyl-5-[(Z)-prop-1-enyl]nona-5,7-diene-2-thiol (PubChem CID 134354782) has the molecular formula C14H24S and a molecular weight of 224.41 g/mol. Its IUPAC name is (5E,7Z)-4,4-dimethyl-5-[(Z)-prop-1-enyl]nona-5,7-diene-2-thiol.
| Compound Name | (5E,7Z)-4,4-dimethyl-5-[(Z)-prop-1-enyl]nona-5,7-diene-2-thiol |
|---|---|
| PubChem CID | 134354782 |
| Molecular Formula | C14H24S |
| Molecular Weight | 224.41 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | (5E,7Z)-4,4-dimethyl-5-[(Z)-prop-1-enyl]nona-5,7-diene-2-thiol |
| SMILES | C/C=C\C=C(/C=C\C)C(C)(C)CC(C)S |
| InChI | InChI=1S/C14H24S/c1-6-8-10-13(9-7-2)14(4,5)11-12(3)15/h6-10,12,15H,11H2,1-5H3/b8-6-,9-7-,13-10+ |
| InChIKey | JIPLTIYVKUYSOV-QWCJMGRLSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|