C8H8F3I — CID 126629591
(1Z,3E,5E)-1-iodo-3-(trifluoromethyl)hepta-1,3,5-triene (PubChem CID 126629591) has the molecular formula C8H8F3I and a molecular weight of 288.05 g/mol. Its IUPAC name is (1Z,3E,5E)-1-iodo-3-(trifluoromethyl)hepta-1,3,5-triene.
| Compound Name | (1Z,3E,5E)-1-iodo-3-(trifluoromethyl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 126629591 |
| Molecular Formula | C8H8F3I |
| Molecular Weight | 288.05 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | (1Z,3E,5E)-1-iodo-3-(trifluoromethyl)hepta-1,3,5-triene |
| SMILES | C/C=C/C=C(\C=C/I)C(F)(F)F |
| InChI | InChI=1S/C8H8F3I/c1-2-3-4-7(5-6-12)8(9,10)11/h2-6H,1H3/b3-2+,6-5-,7-4+ |
| InChIKey | WSRWPBQGPSXRDA-WGIXWNTESA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.05 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|