C19H22F6 — CID 135298694
(2Z,4E,7E,9Z)-5,7-bis[(Z)-prop-1-enyl]-6,6-bis(trifluoromethyl)undeca-2,4,7,9-tetraene (PubChem CID 135298694) has the molecular formula C19H22F6 and a molecular weight of 364.37 g/mol. Its IUPAC name is (2Z,4E,7E,9Z)-5,7-bis[(Z)-prop-1-enyl]-6,6-bis(trifluoromethyl)undeca-2,4,7,9-tetraene.
| Compound Name | (2Z,4E,7E,9Z)-5,7-bis[(Z)-prop-1-enyl]-6,6-bis(trifluoromethyl)undeca-2,4,7,9-tetraene |
|---|---|
| PubChem CID | 135298694 |
| Molecular Formula | C19H22F6 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (2Z,4E,7E,9Z)-5,7-bis[(Z)-prop-1-enyl]-6,6-bis(trifluoromethyl)undeca-2,4,7,9-tetraene |
| SMILES | C/C=C\C=C(/C=C\C)C(C(/C=C\C)=C/C=C\C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H22F6/c1-5-9-13-15(11-7-3)17(18(20,21)22,19(23,24)25)16(12-8-4)14-10-6-2/h5-14H,1-4H3/b9-5-,10-6-,11-7-,12-8-,15-13+,16-14+ |
| InChIKey | WSWPCRZTBMAAJC-VHVPOKRLSA-N |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|