C9H11F5 — CID 163785608
(2E,4E)-4-(1,1-difluoroethyl)-7,7,7-trifluorohepta-2,4-diene (PubChem CID 163785608) has the molecular formula C9H11F5 and a molecular weight of 214.18 g/mol. Its IUPAC name is (2E,4E)-4-(1,1-difluoroethyl)-7,7,7-trifluorohepta-2,4-diene.
| Compound Name | (2E,4E)-4-(1,1-difluoroethyl)-7,7,7-trifluorohepta-2,4-diene |
|---|---|
| PubChem CID | 163785608 |
| Molecular Formula | C9H11F5 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (2E,4E)-4-(1,1-difluoroethyl)-7,7,7-trifluorohepta-2,4-diene |
| SMILES | C/C=C/C(=C\CC(F)(F)F)C(C)(F)F |
| InChI | InChI=1S/C9H11F5/c1-3-4-7(8(2,10)11)5-6-9(12,13)14/h3-5H,6H2,1-2H3/b4-3+,7-5+ |
| InChIKey | MSGNNAPUUHWKBA-BDWKERMESA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|