C11H17F3 — CID 142204097
ethane;(3Z,5Z)-8,8,8-trifluoro-5-methylocta-1,3,5-triene (PubChem CID 142204097) has the molecular formula C11H17F3 and a molecular weight of 206.25 g/mol. Its IUPAC name is ethane;(3Z,5Z)-8,8,8-trifluoro-5-methylocta-1,3,5-triene.
| Compound Name | ethane;(3Z,5Z)-8,8,8-trifluoro-5-methylocta-1,3,5-triene |
|---|---|
| PubChem CID | 142204097 |
| Molecular Formula | C11H17F3 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | ethane;(3Z,5Z)-8,8,8-trifluoro-5-methylocta-1,3,5-triene |
| SMILES | C=C/C=C\C(C)=C/CC(F)(F)F.CC |
| InChI | InChI=1S/C9H11F3.C2H6/c1-3-4-5-8(2)6-7-9(10,11)12;1-2/h3-6H,1,7H2,2H3;1-2H3/b5-4-,8-6-; |
| InChIKey | AILLWQOERZUOOZ-PRWWQMKWSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|