C9H12F3N — CID 166907287
(3E,5Z)-8,8,8-trifluoro-5-methylocta-1,3,5-trien-4-amine (PubChem CID 166907287) has the molecular formula C9H12F3N and a molecular weight of 191.20 g/mol. Its IUPAC name is (3E,5Z)-8,8,8-trifluoro-5-methylocta-1,3,5-trien-4-amine.
| Compound Name | (3E,5Z)-8,8,8-trifluoro-5-methylocta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 166907287 |
| Molecular Formula | C9H12F3N |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (3E,5Z)-8,8,8-trifluoro-5-methylocta-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(N)\C(C)=C/CC(F)(F)F |
| InChI | InChI=1S/C9H12F3N/c1-3-4-8(13)7(2)5-6-9(10,11)12/h3-5H,1,6,13H2,2H3/b7-5-,8-4+ |
| InChIKey | UANROGUGWPPMMC-DZAKWUEVSA-N |
| XLogP | 2.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|