C10H12F3NS — CID 89426000
(1Z,3E)-2-amino-3-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]hexa-1,3,5-triene-1-thiol (PubChem CID 89426000) has the molecular formula C10H12F3NS and a molecular weight of 235.27 g/mol. Its IUPAC name is (1Z,3E)-2-amino-3-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]hexa-1,3,5-triene-1-thiol.
| Compound Name | (1Z,3E)-2-amino-3-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]hexa-1,3,5-triene-1-thiol |
|---|---|
| PubChem CID | 89426000 |
| Molecular Formula | C10H12F3NS |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | (1Z,3E)-2-amino-3-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]hexa-1,3,5-triene-1-thiol |
| SMILES | C=C/C=C(\C=C(/C)C(F)(F)F)C(/N)=C/S |
| InChI | InChI=1S/C10H12F3NS/c1-3-4-8(9(14)6-15)5-7(2)10(11,12)13/h3-6,15H,1,14H2,2H3/b7-5+,8-4+,9-6- |
| InChIKey | YMGGISXTHFGBBY-WEPJTLFRSA-N |
| XLogP | 3.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|