C10H13F3N2O — CID 121464234
(E)-N-[(2Z)-2-aminopenta-2,4-dienyl]-4,4,4-trifluoro-3-methylbut-2-enamide (PubChem CID 121464234) has the molecular formula C10H13F3N2O and a molecular weight of 234.22 g/mol. Its IUPAC name is (E)-N-[(2Z)-2-aminopenta-2,4-dienyl]-4,4,4-trifluoro-3-methylbut-2-enamide.
| Compound Name | (E)-N-[(2Z)-2-aminopenta-2,4-dienyl]-4,4,4-trifluoro-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 121464234 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | (E)-N-[(2Z)-2-aminopenta-2,4-dienyl]-4,4,4-trifluoro-3-methylbut-2-enamide |
| SMILES | C=C/C=C(\N)CNC(=O)/C=C(\C)C(F)(F)F |
| InChI | InChI=1S/C10H13F3N2O/c1-3-4-8(14)6-15-9(16)5-7(2)10(11,12)13/h3-5H,1,6,14H2,2H3,(H,15,16)/b7-5+,8-4- |
| InChIKey | QCGLQMWGHXGHIR-KXSFUDOZSA-N |
| XLogP | 1.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|