C14H15F5O2 — CID 162686711
(3Z,5E,6E)-1,1,1,8,8-pentafluoro-4-hydroxy-7-methyl-5-prop-2-enylidenedeca-3,6-dien-2-one (PubChem CID 162686711) has the molecular formula C14H15F5O2 and a molecular weight of 310.26 g/mol. Its IUPAC name is (3Z,5E,6E)-1,1,1,8,8-pentafluoro-4-hydroxy-7-methyl-5-prop-2-enylidenedeca-3,6-dien-2-one.
| Compound Name | (3Z,5E,6E)-1,1,1,8,8-pentafluoro-4-hydroxy-7-methyl-5-prop-2-enylidenedeca-3,6-dien-2-one |
|---|---|
| PubChem CID | 162686711 |
| Molecular Formula | C14H15F5O2 |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | (3Z,5E,6E)-1,1,1,8,8-pentafluoro-4-hydroxy-7-methyl-5-prop-2-enylidenedeca-3,6-dien-2-one |
| SMILES | C=C/C=C(\C=C(/C)C(F)(F)CC)C(/O)=C/C(=O)C(F)(F)F |
| InChI | InChI=1S/C14H15F5O2/c1-4-6-10(7-9(3)13(15,16)5-2)11(20)8-12(21)14(17,18)19/h4,6-8,20H,1,5H2,2-3H3/b9-7+,10-6+,11-8- |
| InChIKey | WZSNCFSTPIZAKE-WMHOSJRHSA-N |
| XLogP | 4.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|