C8H9F3O — CID 143407155
(3E,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-4-ol (PubChem CID 143407155) has the molecular formula C8H9F3O and a molecular weight of 178.15 g/mol. Its IUPAC name is (3E,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-4-ol.
| Compound Name | (3E,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-4-ol |
|---|---|
| PubChem CID | 143407155 |
| Molecular Formula | C8H9F3O |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | (3E,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-4-ol |
| SMILES | C=C/C=C(O)\C=C(/C)C(F)(F)F |
| InChI | InChI=1S/C8H9F3O/c1-3-4-7(12)5-6(2)8(9,10)11/h3-5,12H,1H2,2H3/b6-5+,7-4+ |
| InChIKey | UIRGIGKWZWRQRZ-HVUXDCMCSA-N |
| XLogP | 3.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|