C9H10F4 — CID 171826400
(3E)-5-fluoro-6-methyl-4-(trifluoromethyl)hepta-1,3,5-triene (PubChem CID 171826400) has the molecular formula C9H10F4 and a molecular weight of 194.17 g/mol. Its IUPAC name is (3E)-5-fluoro-6-methyl-4-(trifluoromethyl)hepta-1,3,5-triene.
| Compound Name | (3E)-5-fluoro-6-methyl-4-(trifluoromethyl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 171826400 |
| Molecular Formula | C9H10F4 |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | (3E)-5-fluoro-6-methyl-4-(trifluoromethyl)hepta-1,3,5-triene |
| SMILES | C=C/C=C(\C(F)=C(C)C)C(F)(F)F |
| InChI | InChI=1S/C9H10F4/c1-4-5-7(9(11,12)13)8(10)6(2)3/h4-5H,1H2,2-3H3/b7-5+ |
| InChIKey | RREUPELGBJDCAT-FNORWQNLSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|